C19H19NO6S — CID 135546621
methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enethioyl]amino]propanoate (PubChem CID 135546621) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enethioyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enethioyl]amino]propanoate |
|---|---|
| PubChem CID | 135546621 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enethioyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=S)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H19NO6S/c1-26-19(25)13(8-12-3-6-15(22)17(24)10-12)20-18(27)7-4-11-2-5-14(21)16(23)9-11/h2-7,9-10,13,21-24H,8H2,1H3,(H,20,27)/b7-4+/t13-/m0/s1 |
| InChIKey | AHYQOMLZFSQSEH-LVDDQXARSA-N |
| XLogP | 2.22 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|