C21H23NO6S — CID 136623093
propan-2-yl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enethioylamino]propanoate (PubChem CID 136623093) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is propan-2-yl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enethioylamino]propanoate.
| Compound Name | propan-2-yl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enethioylamino]propanoate |
|---|---|
| PubChem CID | 136623093 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | propan-2-yl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enethioylamino]propanoate |
| SMILES | CC(C)OC(=O)C(Cc1ccc(O)c(O)c1)NC(=S)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H23NO6S/c1-12(2)28-21(27)15(9-14-4-7-17(24)19(26)11-14)22-20(29)8-5-13-3-6-16(23)18(25)10-13/h3-8,10-12,15,23-26H,9H2,1-2H3,(H,22,29) |
| InChIKey | OMLSQQUIXDRSSO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|