C21H23NO7 — CID 174474730
[(2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]propyl] propanoate (PubChem CID 174474730) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is [(2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]propyl] propanoate.
| Compound Name | [(2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]propyl] propanoate |
|---|---|
| PubChem CID | 174474730 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [(2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]propyl] propanoate |
| SMILES | CCC(=O)OC[C@@H](Cc1ccc(O)c(O)c1)NC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H23NO7/c1-2-21(28)29-12-15(9-14-4-7-17(24)19(26)11-14)22-20(27)8-5-13-3-6-16(23)18(25)10-13/h3-8,10-11,15,23-26H,2,9,12H2,1H3,(H,22,27)/t15-/m1/s1 |
| InChIKey | ZPCVFSIHJHLJGS-OAHLLOKOSA-N |
| XLogP | 2.20 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|