C31H56N2O7S — CID 146298849
methyl 2-[bis(2-methoxy-2-oxoethyl)carbamoylamino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate (PubChem CID 146298849) has the molecular formula C31H56N2O7S and a molecular weight of 600.86 g/mol. Its IUPAC name is methyl 2-[bis(2-methoxy-2-oxoethyl)carbamoylamino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate.
| Compound Name | methyl 2-[bis(2-methoxy-2-oxoethyl)carbamoylamino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 146298849 |
| Molecular Formula | C31H56N2O7S |
| Molecular Weight | 600.86 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | methyl 2-[bis(2-methoxy-2-oxoethyl)carbamoylamino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate |
| SMILES | COC(=O)CN(CC(=O)OC)C(=O)NC(CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)C(=O)OC |
| InChI | InChI=1S/C31H56N2O7S/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-17-26(5)18-19-41-22-27(30(36)40-8)32-31(37)33(20-28(34)38-6)21-29(35)39-7/h18,23-25,27H,9-17,19-22H2,1-8H3,(H,32,37)/b26-18+ |
| InChIKey | DTUZLZGCMOICRY-NLRVBDNBSA-N |
| XLogP | 6.00 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.86 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|