C24H47NO2S — CID 135232003
2-(methylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid (PubChem CID 135232003) has the molecular formula C24H47NO2S and a molecular weight of 413.71 g/mol. Its IUPAC name is 2-(methylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid.
| Compound Name | 2-(methylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 135232003 |
| Molecular Formula | C24H47NO2S |
| Molecular Weight | 413.71 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | 2-(methylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid |
| SMILES | CNC(CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)C(=O)O |
| InChI | InChI=1S/C24H47NO2S/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22(5)16-17-28-18-23(25-6)24(26)27/h16,19-21,23,25H,7-15,17-18H2,1-6H3,(H,26,27)/b22-16+ |
| InChIKey | DWTCDSGVISOITO-CJLVFECKSA-N |
| XLogP | 6.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|