C23H45NO2S — CID 91537464
(2S)-3-sulfanyl-2-(3,7,11,15-tetramethylhexadec-2-enylamino)propanoic acid (PubChem CID 91537464) has the molecular formula C23H45NO2S and a molecular weight of 399.69 g/mol. Its IUPAC name is (2S)-3-sulfanyl-2-(3,7,11,15-tetramethylhexadec-2-enylamino)propanoic acid.
| Compound Name | (2S)-3-sulfanyl-2-(3,7,11,15-tetramethylhexadec-2-enylamino)propanoic acid |
|---|---|
| PubChem CID | 91537464 |
| Molecular Formula | C23H45NO2S |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | (2S)-3-sulfanyl-2-(3,7,11,15-tetramethylhexadec-2-enylamino)propanoic acid |
| SMILES | CC(=CCN[C@H](CS)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C23H45NO2S/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-16-24-22(17-27)23(25)26/h15,18-20,22,24,27H,6-14,16-17H2,1-5H3,(H,25,26)/t19?,20?,22-/m1/s1 |
| InChIKey | HDRJJJUPFMZACG-QETWGEEDSA-N |
| XLogP | 6.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|