C27H49NO5S — CID 52938613
4-[[(1S)-1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-4-oxobutanoic acid (PubChem CID 52938613) has the molecular formula C27H49NO5S and a molecular weight of 499.76 g/mol. Its IUPAC name is 4-[[(1S)-1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(1S)-1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 52938613 |
| Molecular Formula | C27H49NO5S |
| Molecular Weight | 499.76 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | 4-[[(1S)-1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-4-oxobutanoic acid |
| SMILES | C/C(=C\CSC[C@@H](NC(=O)CCC(=O)O)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C27H49NO5S/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)17-18-34-19-24(27(32)33)28-25(29)15-16-26(30)31/h17,20-22,24H,6-16,18-19H2,1-5H3,(H,28,29)(H,30,31)(H,32,33)/b23-17+/t21?,22?,24-/m1/s1 |
| InChIKey | HZYDJYYOVWVJRD-CNMFNTOJSA-N |
| XLogP | 6.54 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.76 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|