C30H55NO4S — CID 159734649
3-methyl-2-(4-oxopentanoylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid (PubChem CID 159734649) has the molecular formula C30H55NO4S and a molecular weight of 525.84 g/mol. Its IUPAC name is 3-methyl-2-(4-oxopentanoylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid.
| Compound Name | 3-methyl-2-(4-oxopentanoylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 159734649 |
| Molecular Formula | C30H55NO4S |
| Molecular Weight | 525.84 g/mol |
| Exact Mass | 525.39 |
| IUPAC Name | 3-methyl-2-(4-oxopentanoylamino)-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid |
| SMILES | CC(=O)CCC(=O)NC(C(=O)O)C(C)(C)SC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C30H55NO4S/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-36-30(7,8)28(29(34)35)31-27(33)19-18-26(6)32/h20,22-24,28H,9-19,21H2,1-8H3,(H,31,33)(H,34,35)/b25-20+ |
| InChIKey | NSCJTXUAVXEJES-LKUDQCMESA-N |
| XLogP | 7.82 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.84 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|