C29H53NO5S — CID 135231920
2-(3-carboxypropanoylamino)-3-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid (PubChem CID 135231920) has the molecular formula C29H53NO5S and a molecular weight of 527.81 g/mol. Its IUPAC name is 2-(3-carboxypropanoylamino)-3-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid.
| Compound Name | 2-(3-carboxypropanoylamino)-3-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 135231920 |
| Molecular Formula | C29H53NO5S |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | 2-(3-carboxypropanoylamino)-3-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbutanoic acid |
| SMILES | C/C(=C\CSC(C)(C)C(NC(=O)CCC(=O)O)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C29H53NO5S/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)19-20-36-29(6,7)27(28(34)35)30-25(31)17-18-26(32)33/h19,21-23,27H,8-18,20H2,1-7H3,(H,30,31)(H,32,33)(H,34,35)/b24-19+ |
| InChIKey | NHZOHTPQQIWXDS-LYBHJNIJSA-N |
| XLogP | 7.32 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|