C30H53NO6S — CID 158960406
5-acetamido-4-oxo-2-[[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylmethyl]heptanedioic acid (PubChem CID 158960406) has the molecular formula C30H53NO6S and a molecular weight of 555.82 g/mol. Its IUPAC name is 5-acetamido-4-oxo-2-[[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylmethyl]heptanedioic acid.
| Compound Name | 5-acetamido-4-oxo-2-[[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylmethyl]heptanedioic acid |
|---|---|
| PubChem CID | 158960406 |
| Molecular Formula | C30H53NO6S |
| Molecular Weight | 555.82 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | 5-acetamido-4-oxo-2-[[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylmethyl]heptanedioic acid |
| SMILES | CC(=O)NC(CC(=O)O)C(=O)CC(CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)C(=O)O |
| InChI | InChI=1S/C30H53NO6S/c1-21(2)10-7-11-22(3)12-8-13-23(4)14-9-15-24(5)16-17-38-20-26(30(36)37)18-28(33)27(19-29(34)35)31-25(6)32/h16,21-23,26-27H,7-15,17-20H2,1-6H3,(H,31,32)(H,34,35)(H,36,37)/b24-16+ |
| InChIKey | QLTVUSIMIWRGAN-LFVJCYFKSA-N |
| XLogP | 6.74 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.82 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|