C27H48N2O2S2 — CID 58167611
2-[(2-methyl-1,3-thiazol-4-yl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid (PubChem CID 58167611) has the molecular formula C27H48N2O2S2 and a molecular weight of 496.83 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 58167611 |
| Molecular Formula | C27H48N2O2S2 |
| Molecular Weight | 496.83 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoic acid |
| SMILES | C/C(=C\CSCC(Nc1csc(C)n1)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C27H48N2O2S2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-15-23(5)16-17-32-18-25(27(30)31)29-26-19-33-24(6)28-26/h16,19-22,25,29H,7-15,17-18H2,1-6H3,(H,30,31)/b23-16+ |
| InChIKey | YQKGPAZMXHTIFV-XQNSMLJCSA-N |
| XLogP | 8.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.83 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|