C29H47F3N2O2S — CID 58167557
3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid (PubChem CID 58167557) has the molecular formula C29H47F3N2O2S and a molecular weight of 544.77 g/mol. Its IUPAC name is 3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid.
| Compound Name | 3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58167557 |
| Molecular Formula | C29H47F3N2O2S |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid |
| SMILES | C/C(=C\CSCC(Nc1ccc(C(F)(F)F)cn1)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C29H47F3N2O2S/c1-21(2)9-6-10-22(3)11-7-12-23(4)13-8-14-24(5)17-18-37-20-26(28(35)36)34-27-16-15-25(19-33-27)29(30,31)32/h15-17,19,21-23,26H,6-14,18,20H2,1-5H3,(H,33,34)(H,35,36)/b24-17+ |
| InChIKey | REUFDRMNIJFNJL-JJIBRWJFSA-N |
| XLogP | 9.08 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|