C9H8F3N3O3S — CID 44546246
3-nitrososulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid (PubChem CID 44546246) has the molecular formula C9H8F3N3O3S and a molecular weight of 295.24 g/mol. Its IUPAC name is 3-nitrososulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid.
| Compound Name | 3-nitrososulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44546246 |
| Molecular Formula | C9H8F3N3O3S |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 3-nitrososulfanyl-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid |
| SMILES | O=NSCC(Nc1ccc(C(F)(F)F)cn1)C(=O)O |
| InChI | InChI=1S/C9H8F3N3O3S/c10-9(11,12)5-1-2-7(13-3-5)14-6(8(16)17)4-19-15-18/h1-3,6H,4H2,(H,13,14)(H,16,17) |
| InChIKey | VLOGHHCCELEWAZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|