C9H10F3N3O2 — CID 100650710
(2S)-2-hydroxy-3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanamide (PubChem CID 100650710) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanamide.
| Compound Name | (2S)-2-hydroxy-3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 100650710 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (2S)-2-hydroxy-3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
| SMILES | NC(=O)[C@@H](O)CNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H10F3N3O2/c10-9(11,12)5-1-2-7(14-3-5)15-4-6(16)8(13)17/h1-3,6,16H,4H2,(H2,13,17)(H,14,15)/t6-/m0/s1 |
| InChIKey | XHXKQVPPVAFBEU-LURJTMIESA-N |
| XLogP | 0.36 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |