C11H14F3N3O — CID 114162427
5-[[5-(trifluoromethyl)-2-pyridinyl]amino]pentanamide (PubChem CID 114162427) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 5-[[5-(trifluoromethyl)-2-pyridinyl]amino]pentanamide.
| Compound Name | 5-[[5-(trifluoromethyl)-2-pyridinyl]amino]pentanamide |
|---|---|
| PubChem CID | 114162427 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 5-[[5-(trifluoromethyl)-2-pyridinyl]amino]pentanamide |
| SMILES | NC(=O)CCCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)8-4-5-10(17-7-8)16-6-2-1-3-9(15)18/h4-5,7H,1-3,6H2,(H2,15,18)(H,16,17) |
| InChIKey | PIFLHAVWJZBRNI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|