C13H17F3N4O — CID 119853879
1-amino-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]cyclopropane-1-carboxamide (PubChem CID 119853879) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-amino-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119853879 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-amino-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]cyclopropane-1-carboxamide |
| SMILES | NC1(C(=O)NCCCNc2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H17F3N4O/c14-13(15,16)9-2-3-10(20-8-9)18-6-1-7-19-11(21)12(17)4-5-12/h2-3,8H,1,4-7,17H2,(H,18,20)(H,19,21) |
| InChIKey | ISIVUAUUHJQICD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|