C10H11F3N2O2 — CID 60631959
methyl 3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoate (PubChem CID 60631959) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is methyl 3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoate.
| Compound Name | methyl 3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
|---|---|
| PubChem CID | 60631959 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | methyl 3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
| SMILES | COC(=O)CCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H11F3N2O2/c1-17-9(16)4-5-14-8-3-2-7(6-15-8)10(11,12)13/h2-3,6H,4-5H2,1H3,(H,14,15) |
| InChIKey | NITJQIXQHFTPPC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |