C19H22F3N3O2 — CID 46399393
4-butoxy-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 46399393) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-butoxy-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 46399393 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-butoxy-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCCNc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C19H22F3N3O2/c1-2-3-12-27-16-7-4-14(5-8-16)18(26)24-11-10-23-17-9-6-15(13-25-17)19(20,21)22/h4-9,13H,2-3,10-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | RMNXHHMAAUPWLU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|