C19H19F3N4O2 — CID 46399286
4-(2-oxopyrrolidin-1-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 46399286) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 46399286 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1ccc(C(F)(F)F)cn1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H19F3N4O2/c20-19(21,22)14-5-8-16(25-12-14)23-9-10-24-18(28)13-3-6-15(7-4-13)26-11-1-2-17(26)27/h3-8,12H,1-2,9-11H2,(H,23,25)(H,24,28) |
| InChIKey | NPSPTEPHVKZHDE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|