C18H19F3N4O3S — CID 55617742
1-methylsulfonyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,3-dihydroindole-5-carboxamide (PubChem CID 55617742) has the molecular formula C18H19F3N4O3S and a molecular weight of 428.44 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 55617742 |
| Molecular Formula | C18H19F3N4O3S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 1-methylsulfonyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,3-dihydroindole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CCc2cc(C(=O)NCCNc3ccc(C(F)(F)F)cn3)ccc21 |
| InChI | InChI=1S/C18H19F3N4O3S/c1-29(27,28)25-9-6-12-10-13(2-4-15(12)25)17(26)23-8-7-22-16-5-3-14(11-24-16)18(19,20)21/h2-5,10-11H,6-9H2,1H3,(H,22,24)(H,23,26) |
| InChIKey | PEYXYNXTHYRTFE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|