C20H25F3N4O3S — CID 55617740
3-(diethylsulfamoyl)-4-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 55617740) has the molecular formula C20H25F3N4O3S and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55617740 |
| Molecular Formula | C20H25F3N4O3S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCCNc2ccc(C(F)(F)F)cn2)ccc1C |
| InChI | InChI=1S/C20H25F3N4O3S/c1-4-27(5-2)31(29,30)17-12-15(7-6-14(17)3)19(28)25-11-10-24-18-9-8-16(13-26-18)20(21,22)23/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,24,26)(H,25,28) |
| InChIKey | WFJVPLYUZWMWBT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|