C19H23F3N4O3S — CID 46426611
3,4-dimethyl-5-(methylsulfamoyl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]benzamide (PubChem CID 46426611) has the molecular formula C19H23F3N4O3S and a molecular weight of 444.48 g/mol. Its IUPAC name is 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]benzamide.
| Compound Name | 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 46426611 |
| Molecular Formula | C19H23F3N4O3S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCCCNc2ccc(C(F)(F)F)cn2)cc(C)c1C |
| InChI | InChI=1S/C19H23F3N4O3S/c1-12-9-14(10-16(13(12)2)30(28,29)23-3)18(27)25-8-4-7-24-17-6-5-15(11-26-17)19(20,21)22/h5-6,9-11,23H,4,7-8H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | ZJIWWSLBPSYLPV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|