C25H21F3N4O3 — CID 46473145
2-(2-methylphenyl)-1,3-dioxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]isoindole-5-carboxamide (PubChem CID 46473145) has the molecular formula C25H21F3N4O3 and a molecular weight of 482.46 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3-dioxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]isoindole-5-carboxamide.
| Compound Name | 2-(2-methylphenyl)-1,3-dioxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 46473145 |
| Molecular Formula | C25H21F3N4O3 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-(2-methylphenyl)-1,3-dioxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]isoindole-5-carboxamide |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)NCCCNc3ccc(C(F)(F)F)cn3)cc2C1=O |
| InChI | InChI=1S/C25H21F3N4O3/c1-15-5-2-3-6-20(15)32-23(34)18-9-7-16(13-19(18)24(32)35)22(33)30-12-4-11-29-21-10-8-17(14-31-21)25(26,27)28/h2-3,5-10,13-14H,4,11-12H2,1H3,(H,29,31)(H,30,33) |
| InChIKey | IXBWONIMDFUDEM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|