C18H15F4N3OS — CID 46427172
4-fluoro-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1-benzothiophene-2-carboxamide (PubChem CID 46427172) has the molecular formula C18H15F4N3OS and a molecular weight of 397.40 g/mol. Its IUPAC name is 4-fluoro-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46427172 |
| Molecular Formula | C18H15F4N3OS |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 4-fluoro-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCNc1ccc(C(F)(F)F)cn1)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C18H15F4N3OS/c19-13-3-1-4-14-12(13)9-15(27-14)17(26)24-8-2-7-23-16-6-5-11(10-25-16)18(20,21)22/h1,3-6,9-10H,2,7-8H2,(H,23,25)(H,24,26) |
| InChIKey | VKXXUSHOQDVROF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|