C20H18F4N4O — CID 46473817
7-fluoro-2-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]quinoline-4-carboxamide (PubChem CID 46473817) has the molecular formula C20H18F4N4O and a molecular weight of 406.38 g/mol. Its IUPAC name is 7-fluoro-2-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]quinoline-4-carboxamide.
| Compound Name | 7-fluoro-2-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46473817 |
| Molecular Formula | C20H18F4N4O |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 7-fluoro-2-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCNc2ccc(C(F)(F)F)cn2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C20H18F4N4O/c1-12-9-16(15-5-4-14(21)10-17(15)28-12)19(29)26-8-2-7-25-18-6-3-13(11-27-18)20(22,23)24/h3-6,9-11H,2,7-8H2,1H3,(H,25,27)(H,26,29) |
| InChIKey | QJBIIJQZYXCBFN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|