C18H22F4IN5 — CID 111232796
1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide (PubChem CID 111232796) has the molecular formula C18H22F4IN5 and a molecular weight of 511.31 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111232796 |
| Molecular Formula | C18H22F4IN5 |
| Molecular Weight | 511.31 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCNc1ccc(C(F)(F)F)cn1)NCc1ccc(F)cc1.I |
| InChI | InChI=1S/C18H21F4N5.HI/c1-23-17(27-11-13-3-6-15(19)7-4-13)25-10-2-9-24-16-8-5-14(12-26-16)18(20,21)22;/h3-8,12H,2,9-11H2,1H3,(H,24,26)(H2,23,25,27);1H |
| InChIKey | BUKVPRFXYYKJCY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|