C15H25F3IN5O — CID 110974588
1-(3-methoxypropyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide (PubChem CID 110974588) has the molecular formula C15H25F3IN5O and a molecular weight of 475.30 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxypropyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110974588 |
| Molecular Formula | C15H25F3IN5O |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1-(3-methoxypropyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCNc1ccc(C(F)(F)F)cn1)NCCCOC.I |
| InChI | InChI=1S/C15H24F3N5O.HI/c1-19-14(22-9-4-10-24-2)21-8-3-7-20-13-6-5-12(11-23-13)15(16,17)18;/h5-6,11H,3-4,7-10H2,1-2H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | NSZVLTACSPUCLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|