C16H19F6IN6S — CID 111616797
2-methyl-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616797) has the molecular formula C16H19F6IN6S and a molecular weight of 568.33 g/mol. Its IUPAC name is 2-methyl-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616797 |
| Molecular Formula | C16H19F6IN6S |
| Molecular Weight | 568.33 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | 2-methyl-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCNc1ccc(C(F)(F)F)cn1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C16H18F6N6S.HI/c1-23-14(27-8-13-28-11(9-29-13)16(20,21)22)25-6-2-5-24-12-4-3-10(7-26-12)15(17,18)19;/h3-4,7,9H,2,5-6,8H2,1H3,(H,24,26)(H2,23,25,27);1H |
| InChIKey | JPRRWWCESWLIPJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|