C18H23F3IN5 — CID 110953159
1-benzyl-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide (PubChem CID 110953159) has the molecular formula C18H23F3IN5 and a molecular weight of 493.32 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-benzyl-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110953159 |
| Molecular Formula | C18H23F3IN5 |
| Molecular Weight | 493.32 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 1-benzyl-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCNc1ccc(C(F)(F)F)cn1)NCc1ccccc1.I |
| InChI | InChI=1S/C18H22F3N5.HI/c1-22-17(26-12-14-6-3-2-4-7-14)24-11-5-10-23-16-9-8-15(13-25-16)18(19,20)21;/h2-4,6-9,13H,5,10-12H2,1H3,(H,23,25)(H2,22,24,26);1H |
| InChIKey | KCMLLJPATGFYOU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|