C15H15F3N2 — CID 60631694
N-(3-phenylpropyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 60631694) has the molecular formula C15H15F3N2 and a molecular weight of 280.29 g/mol. Its IUPAC name is N-(3-phenylpropyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3-phenylpropyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 60631694 |
| Molecular Formula | C15H15F3N2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(3-phenylpropyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NCCCc2ccccc2)nc1 |
| InChI | InChI=1S/C15H15F3N2/c16-15(17,18)13-8-9-14(20-11-13)19-10-4-7-12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2,(H,19,20) |
| InChIKey | TUIHKAUBHXHPGA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|