C9H12F3N3O2S — CID 47299073
3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide (PubChem CID 47299073) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.27 g/mol. Its IUPAC name is 3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 47299073 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H12F3N3O2S/c10-9(11,12)7-2-3-8(15-6-7)14-4-1-5-18(13,16)17/h2-3,6H,1,4-5H2,(H,14,15)(H2,13,16,17) |
| InChIKey | XPITYUBIOGKYPU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|