C19H23F3IN5O2 — CID 111843811
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide (PubChem CID 111843811) has the molecular formula C19H23F3IN5O2 and a molecular weight of 537.32 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111843811 |
| Molecular Formula | C19H23F3IN5O2 |
| Molecular Weight | 537.32 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCNc1ccc(C(F)(F)F)cn1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C19H22F3N5O2.HI/c1-23-18(27-10-13-3-5-15-16(9-13)29-12-28-15)25-8-2-7-24-17-6-4-14(11-26-17)19(20,21)22;/h3-6,9,11H,2,7-8,10,12H2,1H3,(H,24,26)(H2,23,25,27);1H |
| InChIKey | CIIAQBIWGONILR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|