C20H29F3N6O — CID 111675508
2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine (PubChem CID 111675508) has the molecular formula C20H29F3N6O and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine.
| Compound Name | 2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 111675508 |
| Molecular Formula | C20H29F3N6O |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)NCCCNc2ccc(C(F)(F)F)cn2)on1 |
| InChI | InChI=1S/C20H29F3N6O/c1-4-14(5-2)17-11-16(30-29-17)13-28-19(24-3)26-10-6-9-25-18-8-7-15(12-27-18)20(21,22)23/h7-8,11-12,14H,4-6,9-10,13H2,1-3H3,(H,25,27)(H2,24,26,28) |
| InChIKey | OAZPRBCKYNAVOM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|