C20H28F3IN4O2 — CID 111674549
2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111674549) has the molecular formula C20H28F3IN4O2 and a molecular weight of 540.37 g/mol. Its IUPAC name is 2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111674549 |
| Molecular Formula | C20H28F3IN4O2 |
| Molecular Weight | 540.37 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 2-methyl-1-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)NCc2ccccc2OCC(F)(F)F)on1.I |
| InChI | InChI=1S/C20H27F3N4O2.HI/c1-4-14(5-2)17-10-16(29-27-17)12-26-19(24-3)25-11-15-8-6-7-9-18(15)28-13-20(21,22)23;/h6-10,14H,4-5,11-13H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | YDOJRTUCAIDYPG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|