C19H30F3N5O2 — CID 111409125
2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine (PubChem CID 111409125) has the molecular formula C19H30F3N5O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 111409125 |
| Molecular Formula | C19H30F3N5O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]guanidine |
| SMILES | C/N=C(/NCCCNc1ccc(C(F)(F)F)cn1)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C19H30F3N5O2/c1-23-18(26-10-4-11-28-14-16-5-2-12-29-16)25-9-3-8-24-17-7-6-15(13-27-17)19(20,21)22/h6-7,13,16H,2-5,8-12,14H2,1H3,(H,24,27)(H2,23,25,26) |
| InChIKey | DUWOILZWXWBBNH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|