C13H20F3IN4O2S — CID 111618015
methyl 5-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 111618015) has the molecular formula C13H20F3IN4O2S and a molecular weight of 480.29 g/mol. Its IUPAC name is methyl 5-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111618015 |
| Molecular Formula | C13H20F3IN4O2S |
| Molecular Weight | 480.29 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | methyl 5-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCC(=O)OC)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C13H19F3N4O2S.HI/c1-17-12(18-6-4-3-5-11(21)22-2)19-7-10-20-9(8-23-10)13(14,15)16;/h8H,3-7H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | NFEKCJVKMIWWKK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|