C11H16F3N3O — CID 83038922
N-(2-methoxyethyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine (PubChem CID 83038922) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine.
| Compound Name | N-(2-methoxyethyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 83038922 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-(2-methoxyethyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
| SMILES | COCCNCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H16F3N3O/c1-18-7-6-15-4-5-16-10-3-2-9(8-17-10)11(12,13)14/h2-3,8,15H,4-7H2,1H3,(H,16,17) |
| InChIKey | ZGQRKOGXWXYEME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|