C19H22F3N3O2S — CID 46426990
4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]butanamide (PubChem CID 46426990) has the molecular formula C19H22F3N3O2S and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]butanamide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]butanamide |
|---|---|
| PubChem CID | 46426990 |
| Molecular Formula | C19H22F3N3O2S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]butanamide |
| SMILES | Cc1cc(C(=O)CCC(=O)NCCCNc2ccc(C(F)(F)F)cn2)c(C)s1 |
| InChI | InChI=1S/C19H22F3N3O2S/c1-12-10-15(13(2)28-12)16(26)5-7-18(27)24-9-3-8-23-17-6-4-14(11-25-17)19(20,21)22/h4,6,10-11H,3,5,7-9H2,1-2H3,(H,23,25)(H,24,27) |
| InChIKey | SSVHASYRVUDUMU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|