C14H23ClN2O2S — CID 119431451
4-(2,5-dimethylthiophen-3-yl)-N-[3-(methylamino)propyl]-4-oxobutanamide;hydrochloride (PubChem CID 119431451) has the molecular formula C14H23ClN2O2S and a molecular weight of 318.87 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-N-[3-(methylamino)propyl]-4-oxobutanamide;hydrochloride.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-N-[3-(methylamino)propyl]-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 119431451 |
| Molecular Formula | C14H23ClN2O2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-N-[3-(methylamino)propyl]-4-oxobutanamide;hydrochloride |
| SMILES | CNCCCNC(=O)CCC(=O)c1cc(C)sc1C.Cl |
| InChI | InChI=1S/C14H22N2O2S.ClH/c1-10-9-12(11(2)19-10)13(17)5-6-14(18)16-8-4-7-15-3;/h9,15H,4-8H2,1-3H3,(H,16,18);1H |
| InChIKey | WPKWKEXRHGTJSH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|