C19H23NO4S — CID 43009505
4-(2,5-dimethylthiophen-3-yl)-N-[2-(2-methoxyphenoxy)ethyl]-4-oxobutanamide (PubChem CID 43009505) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-N-[2-(2-methoxyphenoxy)ethyl]-4-oxobutanamide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-N-[2-(2-methoxyphenoxy)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 43009505 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-N-[2-(2-methoxyphenoxy)ethyl]-4-oxobutanamide |
| SMILES | COc1ccccc1OCCNC(=O)CCC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C19H23NO4S/c1-13-12-15(14(2)25-13)16(21)8-9-19(22)20-10-11-24-18-7-5-4-6-17(18)23-3/h4-7,12H,8-11H2,1-3H3,(H,20,22) |
| InChIKey | WIJGLSFXWPYTRQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|