C22H27NO5 — CID 38451172
N-[2-(2-methoxyphenoxy)ethyl]-4-oxo-4-(4-propoxyphenyl)butanamide (PubChem CID 38451172) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-4-oxo-4-(4-propoxyphenyl)butanamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-4-oxo-4-(4-propoxyphenyl)butanamide |
|---|---|
| PubChem CID | 38451172 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-4-oxo-4-(4-propoxyphenyl)butanamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)NCCOc2ccccc2OC)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-3-15-27-18-10-8-17(9-11-18)19(24)12-13-22(25)23-14-16-28-21-7-5-4-6-20(21)26-2/h4-11H,3,12-16H2,1-2H3,(H,23,25) |
| InChIKey | ADOIQIFPEIKPIX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|