C20H24N2O5S — CID 24635830
4-(2,5-dimethylthiophen-3-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]-4-oxobutanehydrazide (PubChem CID 24635830) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]-4-oxobutanehydrazide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 24635830 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]-4-oxobutanehydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)CCC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C20H24N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-20(25)22-21-19(24)10-9-16(23)15-11-13(2)28-14(15)3/h5-8,11H,4,9-10,12H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | TXEJXJJEOHMFDK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|