C15H15NO3S — CID 43231129
2-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethoxy]benzamide (PubChem CID 43231129) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 43231129 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethoxy]benzamide |
| SMILES | Cc1cc(C(=O)COc2ccccc2C(N)=O)c(C)s1 |
| InChI | InChI=1S/C15H15NO3S/c1-9-7-12(10(2)20-9)13(17)8-19-14-6-4-3-5-11(14)15(16)18/h3-7H,8H2,1-2H3,(H2,16,18) |
| InChIKey | GIMOHMSPFDEHMS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |