About [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate
[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 8861754) has the molecular formula C15H14O4S
and a molecular weight of 290.34 g/mol. Its IUPAC name is [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate.
Analyze [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate?
The IUPAC name of [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate (CID 8861754) is [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate.
What is the SMILES notation for [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate?
The canonical SMILES for [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate is Cc1cc(C(=O)COC(=O)c2ccccc2O)c(C)s1.
What is the InChIKey of [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate?
The InChIKey is JQAPYGSXKHZLLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O4S/c1-9-7-12(10(2)20-9)14(17)8-19-15(18)11-5-3-4-6-13(11)16/h3-7,16H,8H2,1-2H3.
What are the key properties of [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate?
[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate has a molecular weight of 290.34 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2-hydroxybenzoate is sourced from PubChem (CID 8861754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).