C15H12Cl2O3S — CID 7604414
[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 7604414) has the molecular formula C15H12Cl2O3S and a molecular weight of 343.23 g/mol. Its IUPAC name is [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 7604414 |
| Molecular Formula | C15H12Cl2O3S |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2c(Cl)cccc2Cl)c(C)s1 |
| InChI | InChI=1S/C15H12Cl2O3S/c1-8-6-10(9(2)21-8)13(18)7-20-15(19)14-11(16)4-3-5-12(14)17/h3-6H,7H2,1-2H3 |
| InChIKey | ARMYEJWMWUTXIT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |