C17H15BrO3S — CID 7628370
[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 7628370) has the molecular formula C17H15BrO3S and a molecular weight of 379.28 g/mol. Its IUPAC name is [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7628370 |
| Molecular Formula | C17H15BrO3S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C=C/c2cccc(Br)c2)c(C)s1 |
| InChI | InChI=1S/C17H15BrO3S/c1-11-8-15(12(2)22-11)16(19)10-21-17(20)7-6-13-4-3-5-14(18)9-13/h3-9H,10H2,1-2H3/b7-6+ |
| InChIKey | CXAXLNLLUGZHAP-VOTSOKGWSA-N |
| XLogP | 4.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|