C19H18O5S — CID 8954039
[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 8954039) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8954039 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C=C/c2ccc3c(c2)OCCO3)c(C)s1 |
| InChI | InChI=1S/C19H18O5S/c1-12-9-15(13(2)25-12)16(20)11-24-19(21)6-4-14-3-5-17-18(10-14)23-8-7-22-17/h3-6,9-10H,7-8,11H2,1-2H3/b6-4+ |
| InChIKey | ILDZZVABGJQVPC-GQCTYLIASA-N |
| XLogP | 3.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|