C19H15FO5 — CID 71954356
[2-(4-fluorophenyl)-2-oxoethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 71954356) has the molecular formula C19H15FO5 and a molecular weight of 342.32 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 71954356 |
| Molecular Formula | C19H15FO5 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc2c(c1)OCCO2)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15FO5/c20-15-5-3-14(4-6-15)16(21)12-25-19(22)8-2-13-1-7-17-18(11-13)24-10-9-23-17/h1-8,11H,9-10,12H2 |
| InChIKey | MJQBAOYPLBOGMR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|