C20H17FO5 — CID 7725168
[2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate (PubChem CID 7725168) has the molecular formula C20H17FO5 and a molecular weight of 356.35 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7725168 |
| Molecular Formula | C20H17FO5 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCCCO2)OCC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H17FO5/c21-16-5-2-1-4-15(16)17(22)13-26-20(23)9-7-14-6-8-18-19(12-14)25-11-3-10-24-18/h1-2,4-9,12H,3,10-11,13H2/b9-7+ |
| InChIKey | QDCWOJUSQBMINQ-VQHVLOKHSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|