C17H11Cl2FO3 — CID 7997303
[2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 7997303) has the molecular formula C17H11Cl2FO3 and a molecular weight of 353.18 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7997303 |
| Molecular Formula | C17H11Cl2FO3 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)OCC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H11Cl2FO3/c18-13-7-5-11(9-14(13)19)6-8-17(22)23-10-16(21)12-3-1-2-4-15(12)20/h1-9H,10H2/b8-6+ |
| InChIKey | HLASOONMBCHRSM-SOFGYWHQSA-N |
| XLogP | 4.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|